6-Iodo-pyridine-2-carboxylic acid hydrazide
Catalog No: FT-0678091
CAS No: 851102-43-7
- Chemical Name: 6-Iodo-pyridine-2-carboxylic acid hydrazide
- Molecular Formula: C6H6IN3O
- Molecular Weight: 263.04
- InChI Key: SCUAHTXSISUBKA-UHFFFAOYSA-N
- InChI: InChI=1S/C6H6IN3O/c7-5-3-1-2-4(9-5)6(11)10-8/h1-3H,8H2,(H,10,11)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 263.03600 |
| Density: | 1.989g/cm3 |
| CAS: | 851102-43-7 |
| Bolling_Point: | N/A |
| Product_Name: | 6-iodopyridine-2-carbohydrazide |
| Melting_Point: | 178-179ºC |
| Flash_Point: | N/A |
| MF: | C6H6IN3O |
| Melting_Point: | 178-179ºC |
|---|---|
| Density: | 1.989g/cm3 |
| LogP: | 1.38090 |
| Refractive_Index: | 1.676 |
| FW: | 263.03600 |
| PSA: | 68.01000 |
| MF: | C6H6IN3O |
| Exact_Mass: | 262.95600 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Symbol: | GHS07 |
| Safety_Statements: | H302 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)